| product Name |
heptalene |
| Synonyms |
257-24-9 |
| Molecular Formula |
C12H10 |
| Molecular Weight |
154.2078 |
| InChI |
InChI=1/C12H10/c1-3-7-11-9-5-2-6-10-12(11)8-4-1/h1-10H |
| CAS Registry Number |
257-24-9 |
| Molecular Structure |
|
| Density |
1.03g/cm3 |
| Boiling point |
377.4°C at 760 mmHg |
| Refractive index |
1.623 |
| Flash point |
144.6°C |
| Vapour Pressur |
1.46E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|