| product Name |
Naphthyridine; 98% |
| Synonyms |
1,8-naphthyridine |
| Molecular Formula |
C8H6N2 |
| Molecular Weight |
130.1466 |
| InChI |
InChI=1/C8H6N2/c1-3-7-4-2-6-10-8(7)9-5-1/h1-6H |
| CAS Registry Number |
254-60-4 |
| Molecular Structure |
|
| Density |
1.183g/cm3 |
| Boiling point |
248.9°C at 760 mmHg |
| Refractive index |
1.653 |
| Flash point |
107.8°C |
| Vapour Pressur |
0.0374mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|