| product Name |
4H-1,3-benzodioxin |
| Synonyms |
4H-1,3-Benzodioxin; 4H-1,3-benzodioxine |
| Molecular Formula |
C8H8O2 |
| Molecular Weight |
136.1479 |
| InChI |
InChI=1/C8H8O2/c1-2-4-8-7(3-1)5-9-6-10-8/h1-4H,5-6H2 |
| CAS Registry Number |
254-27-3 |
| EINECS |
205-966-9 |
| Molecular Structure |
|
| Density |
1.15g/cm3 |
| Boiling point |
236.8°C at 760 mmHg |
| Refractive index |
1.538 |
| Flash point |
101.7°C |
| Vapour Pressur |
0.0713mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|