| product Name |
pyrido[2,3-d]pyridazine |
| Synonyms |
1,6,7-Triazanaphthalene |
| Molecular Formula |
C7H5N3 |
| Molecular Weight |
131.1347 |
| InChI |
InChI=1/C7H5N3/c1-2-6-4-9-10-5-7(6)8-3-1/h1-5H |
| CAS Registry Number |
253-73-6 |
| Molecular Structure |
|
| Density |
1.27g/cm3 |
| Boiling point |
354.4°C at 760 mmHg |
| Refractive index |
1.665 |
| Flash point |
179.3°C |
| Vapour Pressur |
6.85E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|