| product Name |
6H,12H-6,12-epoxydibenzo[b,f][1,5]dioxocine |
| Synonyms |
6,12-epoxy-6H,12H-dibenzo[b,f][1,5]dioxocin; 8,16,17-Trioxatetracyclo[7.7.1.0~2,7~.0~10,15~]heptadeca-2,4,6,10,12,14-hexaene |
| Molecular Formula |
C14H10O3 |
| Molecular Weight |
226.2274 |
| InChI |
InChI=1/C14H10O3/c1-3-7-11-9(5-1)13-16-12-8-4-2-6-10(12)14(15-11)17-13/h1-8,13-14H |
| CAS Registry Number |
252-72-2 |
| Molecular Structure |
|
| Density |
1.304g/cm3 |
| Boiling point |
362.2°C at 760 mmHg |
| Refractive index |
1.624 |
| Flash point |
122.2°C |
| Vapour Pressur |
4.11E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|