product Name |
Norharman |
Molecular Formula |
C11H8N2 |
Molecular Weight |
168.1946 |
InChI |
InChI=1/C11H8N2/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10/h1-7,13H |
CAS Registry Number |
244-63-3 |
EINECS |
205-959-0 |
Molecular Structure |
|
Density |
1.301g/cm3 |
Melting point |
198-202℃ |
Boiling point |
391.3°C at 760 mmHg |
Refractive index |
1.784 |
Flash point |
182.1°C |
Vapour Pressur |
5.62E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|