| product Name |
10H-indolo[3,2-b]quinoline |
| Synonyms |
10H-Indolo[3,2-b]quinoline; 10H-quindoline; 243-58-3 |
| Molecular Formula |
C15H10N2 |
| Molecular Weight |
218.2533 |
| InChI |
InChI=1/C15H10N2/c1-3-7-12-10(5-1)9-14-15(17-12)11-6-2-4-8-13(11)16-14/h1-9,16H |
| CAS Registry Number |
243-58-3 |
| Molecular Structure |
|
| Density |
1.336g/cm3 |
| Boiling point |
468.2°C at 760 mmHg |
| Refractive index |
1.839 |
| Flash point |
217.5°C |
| Vapour Pressur |
1.71E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|