| product Name |
11H-indeno[1,2-b]quinoline |
| Synonyms |
11H-Indeno(1,2-b)quinoline; NSC 150251 |
| Molecular Formula |
C16H11N |
| Molecular Weight |
217.2652 |
| InChI |
InChI=1/C16H11N/c1-3-7-14-11(5-1)9-13-10-12-6-2-4-8-15(12)17-16(13)14/h1-8,10H,9H2 |
| CAS Registry Number |
243-51-6 |
| EINECS |
205-958-5 |
| Molecular Structure |
|
| Density |
1.236g/cm3 |
| Boiling point |
410.6°C at 760 mmHg |
| Refractive index |
1.724 |
| Flash point |
184.2°C |
| Vapour Pressur |
1.42E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|