| product Name |
6H-benzo[b]fluorene |
| Synonyms |
|
| Molecular Formula |
C17H12 |
| Molecular Weight |
216.2772 |
| InChI |
InChI=1/C17H12/c1-2-6-13-11-17-15(9-12(13)5-1)10-14-7-3-4-8-16(14)17/h1-5,7-11H,6H2 |
| CAS Registry Number |
243-19-6 |
| Molecular Structure |
|
| Density |
1.2g/cm3 |
| Boiling point |
632.6°C at 760 mmHg |
| Refractive index |
1.715 |
| Flash point |
279.7°C |
| Vapour Pressur |
3.19E-15mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|