| product Name |
1H-cyclopenta[k]tetraphene |
| Synonyms |
|
| Molecular Formula |
C21H14 |
| Molecular Weight |
266.3359 |
| InChI |
InChI=1/C21H14/c1-2-6-18-14(4-1)8-10-16-13-21-17(12-20(16)18)11-9-15-5-3-7-19(15)21/h1-6,8-13H,7H2 |
| CAS Registry Number |
240-44-8 |
| Molecular Structure |
|
| Density |
1.243g/cm3 |
| Boiling point |
505.5°C at 760 mmHg |
| Refractive index |
1.8 |
| Flash point |
252.3°C |
| Vapour Pressur |
7.61E-10mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|