| product Name |
13H-benzo[a]pyrido[2,3-i]carbazole |
| Synonyms |
13H-Benzo(a)pyrido(2,3-i)carbazole |
| Molecular Formula |
C19H12N2 |
| Molecular Weight |
268.312 |
| InChI |
InChI=1/C19H12N2/c1-2-5-13-12(4-1)7-8-14-15-9-10-17-16(6-3-11-20-17)19(15)21-18(13)14/h1-11,21H |
| CAS Registry Number |
239-66-7 |
| Molecular Structure |
|
| Density |
1.358g/cm3 |
| Boiling point |
559.2°C at 760 mmHg |
| Refractive index |
1.876 |
| Flash point |
261.8°C |
| Vapour Pressur |
5.81E-12mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|