| product Name |
benzo[a]fluorene |
| Synonyms |
Benzo(a)fluorene; 1,2-Benzofluorene; Benzo(a)fluorene (VAN); Chrysofluorene; NSC 89262; alpha-Naphthofluorene; 11H-Benzo(a)fluorene |
| Molecular Formula |
C17H12 |
| Molecular Weight |
216.2772 |
| InChI |
InChI=1/C17H12/c1-3-7-14-12(5-1)9-10-16-15-8-4-2-6-13(15)11-17(14)16/h1-10H,11H2 |
| CAS Registry Number |
238-84-6 |
| EINECS |
205-944-9 |
| Molecular Structure |
|
| Density |
1.185g/cm3 |
| Boiling point |
398.3°C at 760 mmHg |
| Refractive index |
1.714 |
| Flash point |
185.4°C |
| Vapour Pressur |
3.43E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|