| product Name |
bisthieno[2,3-b:3',2'-d]thiophene |
| Synonyms |
Dithieno(2,3-b:3',2'-d)thiophene |
| Molecular Formula |
C8H4S3 |
| Molecular Weight |
196.3124 |
| InChI |
InChI=1/C8H4S3/c1-3-9-7-5(1)6-2-4-10-8(6)11-7/h1-4H |
| CAS Registry Number |
236-63-5 |
| Molecular Structure |
|
| Density |
1.556g/cm3 |
| Boiling point |
342.4°C at 760 mmHg |
| Refractive index |
1.865 |
| Flash point |
119.5°C |
| Vapour Pressur |
0.000149mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|