| product Name |
phenanthro[9,10-b]thiophene |
| Synonyms |
Phenanthro(9,10-b)thiophene |
| Molecular Formula |
C16H10S |
| Molecular Weight |
234.3156 |
| InChI |
InChI=1/C16H10S/c1-2-7-13-11(5-1)12-6-3-4-8-14(12)16-15(13)9-10-17-16/h1-10H |
| CAS Registry Number |
236-01-1 |
| Molecular Structure |
|
| Density |
1.292g/cm3 |
| Boiling point |
440.7°C at 760 mmHg |
| Refractive index |
1.809 |
| Flash point |
166.1°C |
| Vapour Pressur |
1.49E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|