| product Name |
Carbamoyl-DL-aspartic acid |
| Synonyms |
Ureidosuccinic acid; N-Carbamyl-DL-aspartic acid Ureidosuccinic acid; (2R)-2-(carbamoylamino)butanedioate; (2S)-2-(carbamoylamino)butanedioate |
| Molecular Formula |
C5H6N2O5 |
| Molecular Weight |
174.1126 |
| InChI |
InChI=1/C5H8N2O5/c6-5(12)7-2(4(10)11)1-3(8)9/h2H,1H2,(H,8,9)(H,10,11)(H3,6,7,12)/p-2/t2-/m0/s1 |
| CAS Registry Number |
923-37-5 |
| EINECS |
213-096-6 |
| Molecular Structure |
|
| Melting point |
174℃ |
| Boiling point |
366.4°C at 760 mmHg |
| Flash point |
175.4°C |
| Vapour Pressur |
2.27E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
