| product Name |
3H-cyclopenta[a]naphthalene |
| Synonyms |
3H-Benz[e]indene; 3H-Cyclopenta[a]naphthalene; LogP |
| Molecular Formula |
C13H10 |
| Molecular Weight |
166.2185 |
| InChI |
InChI=1/C13H10/c1-2-6-12-10(4-1)8-9-11-5-3-7-13(11)12/h1-4,6-9H,5H2 |
| CAS Registry Number |
232-55-3 |
| Molecular Structure |
|
| Density |
1.139g/cm3 |
| Boiling point |
312.183°C at 760 mmHg |
| Refractive index |
1.692 |
| Flash point |
147.476°C |
| Vapour Pressur |
0.001mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|