| product Name |
DL-Bromosuccinic acid |
| Synonyms |
Bromobutanedioic acid; Bromosuccinic Acid; 2-bromobutanedioic acid; (2R)-2-bromobutanedioate; (2S)-2-bromobutanedioate |
| Molecular Formula |
C4H3BrO4 |
| Molecular Weight |
194.9693 |
| InChI |
InChI=1/C4H5BrO4/c5-2(4(8)9)1-3(6)7/h2H,1H2,(H,6,7)(H,8,9)/p-2/t2-/m0/s1 |
| CAS Registry Number |
923-06-8 |
| EINECS |
213-087-7 |
| Molecular Structure |
|
| Melting point |
160-162℃ |
| Boiling point |
255.1°C at 760 mmHg |
| Flash point |
108.1°C |
| Vapour Pressur |
0.00512mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
