| product Name |
quino[6,5-f]quinoline |
| Synonyms |
Quino[6,5-f]quinoline |
| Molecular Formula |
C16H10N2 |
| Molecular Weight |
230.264 |
| InChI |
InChI=1/C16H10N2/c1-3-13-11-5-8-16-14(4-2-10-18-16)12(11)6-7-15(13)17-9-1/h1-10H |
| CAS Registry Number |
218-14-4 |
| Molecular Structure |
|
| Density |
1.291g/cm3 |
| Boiling point |
463.8°C at 760 mmHg |
| Refractive index |
1.796 |
| Flash point |
212.9°C |
| Vapour Pressur |
2.44E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|