| product Name |
tribenzo[a,c,j]tetracene |
| Synonyms |
Tribenz[a,c,j]naphthacene; Tribenzo(a,c,j)naphthacene |
| Molecular Formula |
C30H18 |
| Molecular Weight |
378.4639 |
| InChI |
InChI=1/C30H18/c1-2-8-23-19(7-1)13-14-20-15-21-17-29-26-11-5-3-9-24(26)25-10-4-6-12-27(25)30(29)18-22(21)16-28(20)23/h1-18H |
| CAS Registry Number |
215-96-3 |
| Molecular Structure |
|
| Density |
1.286g/cm3 |
| Boiling point |
677°C at 760 mmHg |
| Refractive index |
1.867 |
| Flash point |
360.6°C |
| Vapour Pressur |
2E-17mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|