| product Name |
1,2,3,4-Dibenzanthracene |
| Synonyms |
Dibenz[a,c]anthracene; dibenz(a,c)anthracene; 1,2:3,4-dibenzanthracene; Benztriphenylene; 2,3-Benztriphenylene; benzo[f]tetraphene |
| Molecular Formula |
C22H14 |
| Molecular Weight |
278.3466 |
| InChI |
InChI=1/C22H14/c1-2-8-16-14-22-20-12-6-4-10-18(20)17-9-3-5-11-19(17)21(22)13-15(16)7-1/h1-14H |
| CAS Registry Number |
215-58-7 |
| EINECS |
205-920-8 |
| Molecular Structure |
|
| Density |
1.232g/cm3 |
| Melting point |
202-207℃ |
| Boiling point |
518°C at 760 mmHg |
| Refractive index |
1.811 |
| Flash point |
264.5°C |
| Vapour Pressur |
2.55E-10mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R40:Possible risks of irreversible effects.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|