| product Name |
tribenzo[a,c,h]phenazine |
| Synonyms |
9,16-Diazatribenz[a,c,h]anthracene; Tribenzo[a,c,h]phenazine |
| Molecular Formula |
C24H14N2 |
| Molecular Weight |
330.3814 |
| InChI |
InChI=1/C24H14N2/c1-2-8-16-15(7-1)13-14-21-22(16)26-24-20-12-6-4-10-18(20)17-9-3-5-11-19(17)23(24)25-21/h1-14H |
| CAS Registry Number |
215-29-2 |
| Molecular Structure |
|
| Density |
1.34g/cm3 |
| Boiling point |
623°C at 760 mmHg |
| Refractive index |
1.866 |
| Flash point |
289.6°C |
| Vapour Pressur |
9.08E-15mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|