| product Name |
dibenzo[b,n]picene |
| Synonyms |
Dibenzo(b,n)picene; Dibenzo[b,n]picene |
| Molecular Formula |
C30H18 |
| Molecular Weight |
378.4639 |
| InChI |
InChI=1/C30H18/c1-3-7-21-17-29-23(15-19(21)5-1)9-11-25-26-12-10-24-16-20-6-2-4-8-22(20)18-30(24)28(26)14-13-27(25)29/h1-18H |
| CAS Registry Number |
213-44-5 |
| Molecular Structure |
|
| Density |
1.286g/cm3 |
| Boiling point |
677°C at 760 mmHg |
| Refractive index |
1.867 |
| Flash point |
360.6°C |
| Vapour Pressur |
2E-17mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|