| product Name |
tetraphenylene |
| Synonyms |
212-74-8 |
| Molecular Formula |
C24H16 |
| Molecular Weight |
304.3838 |
| InChI |
InChI=1/C24H16/c1-2-10-18-17(9-1)19-11-3-4-13-21(19)23-15-7-8-16-24(23)22-14-6-5-12-20(18)22/h1-16H/b19-17-,20-18-,23-21-,24-22- |
| CAS Registry Number |
212-74-8;7234-88-0 |
| Molecular Structure |
|
| Density |
1.19g/cm3 |
| Boiling point |
577.6°C at 760 mmHg |
| Refractive index |
1.757 |
| Flash point |
297.9°C |
| Vapour Pressur |
9.72E-13mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|