| product Name |
Benzo[b]naphtho[1,2-d]furan (purity) |
| Synonyms |
Benzo(b)naphtho(1,2-d)furan; NSC 109422; benzo[b]naphtho[2,1-d]furan |
| Molecular Formula |
C16H10O |
| Molecular Weight |
218.25 |
| InChI |
InChI=1/C16H10O/c1-2-6-12-11(5-1)9-10-15-16(12)13-7-3-4-8-14(13)17-15/h1-10H |
| CAS Registry Number |
205-39-0 |
| EINECS |
205-947-5 |
| Molecular Structure |
|
| Density |
1.25g/cm3 |
| Boiling point |
394.1°C at 760 mmHg |
| Refractive index |
1.763 |
| Flash point |
208.3°C |
| Vapour Pressur |
4.62E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|