| product Name |
2H-pyrano[4,3,2-de]chromene |
| Synonyms |
2H-Pyrano(4,3,2-de)-1-benzopyran |
| Molecular Formula |
C11H8O2 |
| Molecular Weight |
172.18 |
| InChI |
InChI=1/C11H8O2/c1-2-9-11-8(4-6-12-9)5-7-13-10(11)3-1/h1-6H,7H2 |
| CAS Registry Number |
203-98-5 |
| Molecular Structure |
|
| Density |
1.29g/cm3 |
| Boiling point |
351.9°C at 760 mmHg |
| Refractive index |
1.656 |
| Flash point |
165.2°C |
| Vapour Pressur |
8.06E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|