| product Name |
aceanthrylene |
| Synonyms |
202-03-9 |
| Molecular Formula |
C16H10 |
| Molecular Weight |
202.2506 |
| InChI |
InChI=1/C16H10/c1-2-7-14-12(4-1)10-13-6-3-5-11-8-9-15(14)16(11)13/h1-10H |
| CAS Registry Number |
202-03-9 |
| Molecular Structure |
|
| Density |
1.246g/cm3 |
| Boiling point |
405.7°C at 760 mmHg |
| Refractive index |
1.795 |
| Flash point |
188.6°C |
| Vapour Pressur |
2.01E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|