| product Name |
2-Nitrophenylhydrazine |
| Synonyms |
BRN 0512797; Hydrazine, (o-nitrophenyl)- |
| Molecular Formula |
C6H7N3O2 |
| Molecular Weight |
153.1387 |
| InChI |
InChI=1/C6H7N3O2/c7-8-5-3-1-2-4-6(5)9(10)11/h1-4,8H,7H2 |
| CAS Registry Number |
3034-19-3 |
| EINECS |
221-222-6 |
| Molecular Structure |
|
| Density |
1.419g/cm3 |
| Melting point |
89-94℃ |
| Boiling point |
314.3°C at 760 mmHg |
| Refractive index |
1.691 |
| Flash point |
143.9°C |
| Vapour Pressur |
0.000469mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R5:Heating may cause an explosion.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
