product Name |
2',4'-Difluoroacetanilide |
Synonyms |
2,4-Difluoroacetanilide; N-(2,4-difluorophenyl)acetamide |
Molecular Formula |
C8H7F2NO |
Molecular Weight |
171.1441 |
InChI |
InChI=1/C8H7F2NO/c1-5(12)11-8-3-2-6(9)4-7(8)10/h2-4H,1H3,(H,11,12) |
CAS Registry Number |
399-36-0 |
Molecular Structure |
|
Density |
1.307g/cm3 |
Boiling point |
276.8°C at 760 mmHg |
Refractive index |
1.531 |
Flash point |
121.2°C |
Vapour Pressur |
0.0047mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|