product Name |
3,3'-difluorobiphenyl |
Synonyms |
3,3-Difluorodiphenyl |
Molecular Formula |
C12H8F2 |
Molecular Weight |
190.1887 |
InChI |
InChI=1/C12H8F2/c13-11-5-1-3-9(7-11)10-4-2-6-12(14)8-10/h1-8H |
CAS Registry Number |
396-64-5 |
EINECS |
206-905-9 |
Molecular Structure |
|
Density |
1.165g/cm3 |
Melting point |
6℃ |
Boiling point |
262.2°C at 760 mmHg |
Refractive index |
1.535 |
Flash point |
92.7°C |
Vapour Pressur |
0.018mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|