product Name |
5-Chloro-2-fluorobenzoic acid |
Synonyms |
BUTTPARK 14\01-27; RARECHEM AL BO 0944; 5-CHLORO-2-FLUOROBENZOIC ACI; 5-Chloro-2-Fluorobenzoic Acid 2-Fluoro-5-Chlorobenzoic Acid; 5-Chloro-2-fluorobenzoicacid,97%; 5-Chloro-2-Fluorobenzoic; 1-(5-fluoro-2-hydroxyphenyl)ethanone; 5-chloro-2-fluorobenzoate |
Molecular Formula |
C7H3ClFO2 |
Molecular Weight |
173.5495 |
InChI |
InChI=1/C7H4ClFO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11)/p-1 |
CAS Registry Number |
394-30-9 |
EINECS |
206-893-5 |
Molecular Structure |
|
Melting point |
152-153℃ |
Boiling point |
274.7°C at 760 mmHg |
Flash point |
120°C |
Vapour Pressur |
0.00257mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|