| product Name |
5-Chloro-2-fluorobenzoic acid |
| Synonyms |
BUTTPARK 14\01-27; RARECHEM AL BO 0944; 5-CHLORO-2-FLUOROBENZOIC ACI; 5-Chloro-2-Fluorobenzoic Acid 2-Fluoro-5-Chlorobenzoic Acid; 5-Chloro-2-fluorobenzoicacid,97%; 5-Chloro-2-Fluorobenzoic; 1-(5-fluoro-2-hydroxyphenyl)ethanone; 5-chloro-2-fluorobenzoate |
| Molecular Formula |
C7H3ClFO2 |
| Molecular Weight |
173.5495 |
| InChI |
InChI=1/C7H4ClFO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11)/p-1 |
| CAS Registry Number |
394-30-9 |
| EINECS |
206-893-5 |
| Molecular Structure |
|
| Melting point |
152-153℃ |
| Boiling point |
274.7°C at 760 mmHg |
| Flash point |
120°C |
| Vapour Pressur |
0.00257mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
