product Name |
2-Chloro-6-fluorocinnamic acid |
Synonyms |
3-(2-Chloro-6-fluorophenyl)acrylic acid; (2E)-3-(2-chloro-6-fluorophenyl)prop-2-enoic acid; (2E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate; (Z)-3-(2-chloro-6-fluoro-phenyl)prop-2-enoic acid |
Molecular Formula |
C9H6ClFO2 |
Molecular Weight |
200.5941 |
InChI |
InChI=1/C9H6ClFO2/c10-7-2-1-3-8(11)6(7)4-5-9(12)13/h1-5H,(H,12,13)/b5-4- |
CAS Registry Number |
392-22-3 |
Molecular Structure |
|
Density |
1.42g/cm3 |
Boiling point |
312.8°C at 760 mmHg |
Refractive index |
1.604 |
Flash point |
143°C |
Vapour Pressur |
0.00022mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|