| product Name |
Methyl 4-fluoro-2-hydroxybenzoate |
| Synonyms |
Methyl 4-fluorosalicylate; 4-Fluorosalicylic acid methyl ester~Methyl 4-fluoro-2-hydroxybenzoate |
| Molecular Formula |
C8H7FO3 |
| Molecular Weight |
170.1378 |
| InChI |
InChI=1/C8H7FO3/c1-12-8(11)6-3-2-5(9)4-7(6)10/h2-4,10H,1H3 |
| CAS Registry Number |
392-04-1 |
| Molecular Structure |
|
| Density |
1.309g/cm3 |
| Boiling point |
224.7°C at 760 mmHg |
| Refractive index |
1.526 |
| Flash point |
89.7°C |
| Vapour Pressur |
0.0603mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
