| product Name |
3-(4-Fluorobenzoyl)propionic acid |
| Synonyms |
Haloperidol metabolite III; ; 4-(4-fluorophenyl)-4-oxobutanoic acid |
| Molecular Formula |
C10H9FO3 |
| Molecular Weight |
196.1751 |
| InChI |
InChI=1/C10H9FO3/c11-8-3-1-7(2-4-8)9(12)5-6-10(13)14/h1-4H,5-6H2,(H,13,14) |
| CAS Registry Number |
366-77-8 |
| EINECS |
206-679-1 |
| Molecular Structure |
|
| Density |
1.283g/cm3 |
| Melting point |
100-102℃ |
| Boiling point |
374.4°C at 760 mmHg |
| Refractive index |
1.528 |
| Flash point |
180.3°C |
| Vapour Pressur |
2.85E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|