product Name |
N,N,N',N'-Tetramethylbenzidine |
Synonyms |
[1,1'-Biphenyl]-4,4'-diamine, N,N,N',N'-tetramethyl-; [1,1'-biphenyl]-4,4'-diamine, N~4~,N~4~,N~4'~,N~4'~-tetramethyl-; N,N,N',N'-Tetramethyl-4,4'-biphenyldiamine; N,N,N',N'-Tetramethylbiphenyl-4,4'-diamine |
Molecular Formula |
C16H20N2 |
Molecular Weight |
240.3434 |
InChI |
InChI=1/C16H20N2/c1-17(2)15-9-5-13(6-10-15)14-7-11-16(12-8-14)18(3)4/h5-12H,1-4H3 |
CAS Registry Number |
366-29-0 |
EINECS |
206-676-5 |
Molecular Structure |
|
Density |
1.041g/cm3 |
Melting point |
192-196℃ |
Boiling point |
387.1°C at 760 mmHg |
Refractive index |
1.605 |
Flash point |
173.4°C |
Vapour Pressur |
3.38E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|