product Name |
4-Fluoro-1-iodo-2-nitrobenzene |
Synonyms |
2-Iodo-5-fluoronitrobenzene |
Molecular Formula |
C6H5FN2O2 |
Molecular Weight |
156.1145 |
InChI |
InChI=1/C6H5FN2O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,8H2 |
CAS Registry Number |
364-77-2 |
EINECS |
206-666-0 |
Molecular Structure |
|
Density |
1.448g/cm3 |
Boiling point |
295.1°C at 760 mmHg |
Refractive index |
1.603 |
Flash point |
89.4°C |
Vapour Pressur |
0.00155mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|