| product Name |
oxalyl fluoride |
| Synonyms |
Ethanedioyl difluoride; 4-02-00-01853 (Beilstein Handbook Reference); BRN 1743349; Difluorid kyseliny stavelove; Difluorid kyseliny stavelove [Czech]; Oxalyl difluoride; Oxalyl fluoride; TL 108 |
| Molecular Formula |
C2F2O2 |
| Molecular Weight |
94.017 |
| InChI |
InChI=1/C2F2O2/c3-1(5)2(4)6 |
| CAS Registry Number |
359-40-0 |
| EINECS |
206-630-4 |
| Molecular Structure |
|
| Density |
1.409g/cm3 |
| Boiling point |
85.6°C at 760 mmHg |
| Refractive index |
1.28 |
| Flash point |
21.9°C |
| Vapour Pressur |
68.9mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
R37:Irritating to respiratory system.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
