| product Name |
iodotrifluoroethylene |
| Synonyms |
Trifluoroiodoethylene; 1,1,2-trifluoro-2-iodoethene |
| Molecular Formula |
C2F3I |
| Molecular Weight |
207.9211 |
| InChI |
InChI=1/C2F3I/c3-1(4)2(5)6 |
| CAS Registry Number |
359-37-5 |
| EINECS |
206-629-9 |
| Molecular Structure |
|
| Density |
2.311g/cm3 |
| Boiling point |
30°C at 760 mmHg |
| Refractive index |
1.457 |
| Vapour Pressur |
636mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
