| product Name |
6,7-Bis(benzyloxy)coumarin |
| Synonyms |
Esculetin dibenzyl ether; 6,7-bis(benzyloxy)-2H-chromen-2-one |
| Molecular Formula |
C23H18O4 |
| Molecular Weight |
358.3866 |
| InChI |
InChI=1/C23H18O4/c24-23-12-11-19-13-21(25-15-17-7-3-1-4-8-17)22(14-20(19)27-23)26-16-18-9-5-2-6-10-18/h1-14H,15-16H2 |
| CAS Registry Number |
909-84-2 |
| EINECS |
213-003-9 |
| Molecular Structure |
|
| Density |
1.25g/cm3 |
| Boiling point |
560.2°C at 760 mmHg |
| Refractive index |
1.631 |
| Flash point |
246°C |
| Vapour Pressur |
1.4E-12mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|