product Name |
2,5-Bis(1-naphthyl)-1,3,4-oxadiazole |
Synonyms |
2,5-Di(1-naphthyl)-1,3,4-oxadiazole; 2,5-di(naphthalen-1-yl)-1,3,4-oxadiazole |
Molecular Formula |
C22H14N2O |
Molecular Weight |
322.3594 |
InChI |
InChI=1/C22H14N2O/c1-3-11-17-15(7-1)9-5-13-19(17)21-23-24-22(25-21)20-14-6-10-16-8-2-4-12-18(16)20/h1-14H |
CAS Registry Number |
905-62-4 |
EINECS |
212-995-0 |
Molecular Structure |
|
Density |
1.251g/cm3 |
Boiling point |
556.4°C at 760 mmHg |
Refractive index |
1.7 |
Flash point |
293.1°C |
Vapour Pressur |
7.55E-12mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|