| product Name |
Harmine hydrochloride hydrate |
| Synonyms |
7-Methoxy-1-methyl-9H-pyrido[3,4-b]indole hydrochloride hydrate; Harmine hydrochlorid; Banisterine, Telepathine; 7-methoxy-1-methyl-9H-beta-carbolin-9-ium chloride |
| Molecular Formula |
C13H13ClN2O |
| Molecular Weight |
248.7081 |
| InChI |
InChI=1/C13H12N2O.ClH/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13;/h3-7,15H,1-2H3;1H |
| CAS Registry Number |
343-27-1 |
| EINECS |
206-443-8 |
| Molecular Structure |
|
| Melting point |
265-270℃ |
| Boiling point |
421.4°C at 760 mmHg |
| Flash point |
139.8°C |
| Vapour Pressur |
6.42E-07mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R40:Possible risks of irreversible effects.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
