| product Name |
Triphenylcarbenium tetrafluoroborate |
| Synonyms |
Trityl fluoroborate; Tritylium tetrafluoroborate; Trityl tetrafluoroborate; triphenylmethylium tetrafluoroborate |
| Molecular Formula |
C19H15BF4 |
| Molecular Weight |
330.127 |
| InChI |
InChI=1/C19H15.BF4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4)5/h1-15H;/q+1;-1 |
| CAS Registry Number |
341-02-6 |
| EINECS |
206-433-3 |
| Molecular Structure |
|
| Melting point |
205-215℃ |
| Hazard Symbols |
C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|