| product Name |
(4-fluorophenylthio)acetic acid |
| Synonyms |
2-[(4-Fluorophenyl)thio]acetic acid; [(4-fluorophenyl)sulfanyl]acetic acid; [(4-fluorophenyl)sulfanyl]acetate |
| Molecular Formula |
C8H6FO2S |
| Molecular Weight |
185.196 |
| InChI |
InChI=1/C8H7FO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
| CAS Registry Number |
332-51-4 |
| Molecular Structure |
|
| Melting point |
76-79℃ |
| Boiling point |
315.4°C at 760 mmHg |
| Flash point |
144.5°C |
| Vapour Pressur |
0.000185mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
