product Name |
4-Fluorophenoxy-ethylbromide |
Synonyms |
1-(2-Bromoethoxy)-4-fluorobenzene; 1-(1-bromoethoxy)-4-fluorobenzene |
Molecular Formula |
C8H8BrFO |
Molecular Weight |
219.0509 |
InChI |
InChI=1/C8H8BrFO/c1-6(9)11-8-4-2-7(10)3-5-8/h2-6H,1H3 |
CAS Registry Number |
332-48-9 |
Molecular Structure |
|
Density |
1.483g/cm3 |
Boiling point |
242.309°C at 760 mmHg |
Refractive index |
1.525 |
Flash point |
119.849°C |
Vapour Pressur |
0.053mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|