| product Name |
1-(2-chloroethyl)-4-fluorobenzene |
| Synonyms |
4-Fluorophenethyl chloride~2-(4-Fluorophenyl)ethyl chloride |
| Molecular Formula |
C8H8ClF |
| Molecular Weight |
158.6005 |
| InChI |
InChI=1/C8H8ClF/c9-6-5-7-1-3-8(10)4-2-7/h1-4H,5-6H2 |
| CAS Registry Number |
332-43-4 |
| EINECS |
206-364-9 |
| Molecular Structure |
|
| Density |
1.15g/cm3 |
| Boiling point |
204.6°C at 760 mmHg |
| Refractive index |
1.501 |
| Flash point |
79.9°C |
| Vapour Pressur |
0.373mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
