| product Name |
Fluoromethoxybenzonitrile5 |
| Synonyms |
4-Fluoro-3-methoxybenzonitrile; 3-fluoro-4-methoxybenzonitrile |
| Molecular Formula |
C8H6FNO |
| Molecular Weight |
151.1377 |
| InChI |
InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
| CAS Registry Number |
331-62-4 |
| Molecular Structure |
|
| Density |
1.18g/cm3 |
| Boiling point |
254.3°C at 760 mmHg |
| Refractive index |
1.505 |
| Flash point |
107.6°C |
| Vapour Pressur |
0.0173mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
