product Name |
4-(4-Fluorophenyl)-3-thiosemicarbazide |
Synonyms |
-; N-(4-fluorophenyl)hydrazinecarbothioamide |
Molecular Formula |
C7H8FN3S |
Molecular Weight |
185.2219 |
InChI |
InChI=1/C7H8FN3S/c8-5-1-3-6(4-2-5)10-7(12)11-9/h1-4H,9H2,(H2,10,11,12) |
CAS Registry Number |
330-94-9 |
Molecular Structure |
|
Density |
1.418g/cm3 |
Boiling point |
285°C at 760 mmHg |
Refractive index |
1.696 |
Flash point |
126.2°C |
Vapour Pressur |
0.00287mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R25:Toxic if swallowed.;
|
Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|