| product Name |
5-Fluoro-2-methylphenylhydrazine hydrochloride |
| Synonyms |
-; (5-fluoro-2-methylphenyl)diazanium chloride; (5-fluoro-2-methylphenyl)hydrazine |
| Molecular Formula |
C7H9FN2 |
| Molecular Weight |
140.1582 |
| InChI |
InChI=1/C7H9FN2/c1-5-2-3-6(8)4-7(5)10-9/h2-4,10H,9H2,1H3 |
| CAS Registry Number |
325-50-8 |
| Molecular Structure |
|
| Density |
1.202g/cm3 |
| Boiling point |
212°C at 760 mmHg |
| Refractive index |
1.594 |
| Flash point |
82°C |
| Vapour Pressur |
0.177mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
