| product Name |
2-fluoro-6-methylnaphthalene |
| Synonyms |
- |
| Molecular Formula |
C11H9F |
| Molecular Weight |
160.1876 |
| InChI |
InChI=1/C11H9F/c1-8-2-3-10-7-11(12)5-4-9(10)6-8/h2-7H,1H3 |
| CAS Registry Number |
324-42-5 |
| Molecular Structure |
|
| Density |
1.112g/cm3 |
| Melting point |
72℃ |
| Boiling point |
247.5°C at 760 mmHg |
| Refractive index |
1.594 |
| Flash point |
84.5°C |
| Vapour Pressur |
0.0403mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
