product Name |
2-fluoro-6-methylnaphthalene |
Synonyms |
- |
Molecular Formula |
C11H9F |
Molecular Weight |
160.1876 |
InChI |
InChI=1/C11H9F/c1-8-2-3-10-7-11(12)5-4-9(10)6-8/h2-7H,1H3 |
CAS Registry Number |
324-42-5 |
Molecular Structure |
|
Density |
1.112g/cm3 |
Melting point |
72℃ |
Boiling point |
247.5°C at 760 mmHg |
Refractive index |
1.594 |
Flash point |
84.5°C |
Vapour Pressur |
0.0403mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|