| product Name |
Tacrine |
| Synonyms |
THA; 1,2,3,4-Tetrahydro-9-acridinamine; 9-Amino-1,2,3,4-tetrahydroacridine; Cognex |
| Molecular Formula |
C13H14N2.HCl.H2O |
| Molecular Weight |
252.74 |
| InChI |
InChI=1/C13H14N2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1,3,5,7H,2,4,6,8H2,(H2,14,15) |
| CAS Registry Number |
321-64-2 |
| EINECS |
206-291-2 |
| Molecular Structure |
|
| Melting point |
283-284℃ |
| Hazard Symbols |
 T:Toxic;
|
| Risk Codes |
R25:Toxic if swallowed.;
|
| Safety Description |
S28A:After contact with skin, wash immediately with plenty of water.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
