| product Name |
1-methyl-4-(10-oxido-9H-thioxanthen-9-ylidene)piperidine |
| Synonyms |
|
| Molecular Formula |
C19H19NOS |
| Molecular Weight |
309.4253 |
| InChI |
InChI=1/C19H19NOS/c1-20-12-10-14(11-13-20)19-15-6-2-4-8-17(15)22(21)18-9-5-3-7-16(18)19/h2-9H,10-13H2,1H3 |
| CAS Registry Number |
314-01-2 |
| Molecular Structure |
|
| Density |
1.31g/cm3 |
| Boiling point |
499.6°C at 760 mmHg |
| Refractive index |
1.707 |
| Flash point |
255.9°C |
| Vapour Pressur |
4.1E-10mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|